| Approval: | ISO |
|---|---|
| IUPAC PIN: | {2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl}{[(diphenylmethylidene)amino]oxy}methanone |
| IUPAC name: | benzophenone O-{2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoyl}oxime |
| CAS name: | diphenylmethanone O-[2,6-bis[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzoyl]oxime |
| CAS Reg. No.: | 168088-61-7 |
| Formula: | C32H27N5O8 |
| Activity: | herbicides (pyrimidinyl benzoate) |
| Notes: | The parent acid has its own ISO common name, bispyribac [125401-75-4]. |
| Structure: | |
| Pronunciation: | pǐ-rǐ-běnz-ǒks-ǐm Guide to British pronunciation |
| InChIKey: | OVXMBIVWNJDDSM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C32H27N5O8/c1-39-24-18-25(40-2)34-31(33-24)43-22-16-11-17-23(44-32-35-26(41-3)19-27(36-32)42-4)28(22)30(38)45-37-29(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names