Status: | WHO INN |
---|---|
IUPAC PIN: | 2,2′-sulfanediylbis(4,6-dichlorophenol) |
IUPAC name: | 2,2′-thiobis(4,6-dichlorophenol) |
CAS name: | 2,2′-thiobis[4,6-dichlorophenol] |
CAS Reg. No.: | 97-18-7 |
Formula: | C12H6Cl4O2S |
Activity: | fungicides (phenol) |
Notes: | There is no ISO common name for this substance; the name “bithionol” is approved by the World Health Organization. |
Structure: | |
Pronunciation: | bī-thī-ǒn-ǒl Guide to British pronunciation |
InChIKey: | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
A data sheet from the Compendium of Pesticide Common Names