| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | 2,2′-sulfanediylbis(4,6-dichlorophenol) |
| IUPAC name: | 2,2′-thiobis(4,6-dichlorophenol) |
| CAS name: | 2,2′-thiobis[4,6-dichlorophenol] |
| CAS Reg. No.: | 97-18-7 |
| Formula: | C12H6Cl4O2S |
| Activity: | fungicides (phenol) |
| Notes: | There is no ISO common name for this substance; the name “bithionol” is approved by the World Health Organization. |
| Structure: | |
| Pronunciation: | bī-thī-ǒn-ǒl Guide to British pronunciation |
| InChIKey: | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
A data sheet from the Compendium of Pesticide Common Names