Approval: | ISO |
---|---|
IUPAC PIN: | 2-chloro-N-(4′-chloro[1,1′-biphenyl]-2-yl)pyridine-3-carboxamide |
IUPAC name: | 2-chloro-N-(4′-chlorobiphenyl-2-yl)pyridine-3-carboxamide 1979 Rules: 2-chloro-2′-(4-chlorophenyl)nicotinanilide |
CAS name: | 2-chloro-N-(4′-chloro[1,1′-biphenyl]-2-yl)-3-pyridinecarboxamide |
CAS Reg. No.: | 188425-85-6 |
Formula: | C18H12Cl2N2O |
Activity: | fungicides (pyridinecarboxamide) |
Notes: | The name “nicobifen” was provisionally approved for this substance, but was replaced at the request of the sponsor. |
Structure: | |
Pronunciation: | bǒs-ka-lǐd Guide to British pronunciation |
InChIKey: | WYEMLYFITZORAB-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H12Cl2N2O/c19-13-9-7-12(8-10-13)14-4-1-2-6-16(14)22-18(23)15-5-3-11-21-17(15)20/h1-11H,(H,22,23) |
A data sheet from the Compendium of Pesticide Common Names