| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | rac-(2R)-butan-2-amine |
| IUPAC name: | (2RS)-butan-2-amine 1979 Rules: (RS)-sec-butylamine |
| CAS name: | 2-butanamine |
| CAS Reg. No.: | 13952-84-6 |
| Formula: | C4H11N |
| Activity: | fungicides (aliphatic nitrogen) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | bū-tīl-a-mēn Guide to British pronunciation |
| InChIKey: | BHRZNVHARXXAHW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names