| Approval: | ISO |
|---|---|
| IUPAC PIN: | 6-methyl-2H-[1,3]dithiolo[4,5-b]quinoxalin-2-one |
| IUPAC name: | 6-methyl-1,3-dithiolo[4,5-b]quinoxalin-2-one or S,S-(6-methylquinoxaline-2,3-diyl) dithiocarbonate |
| CAS name: | 6-methyl-1,3-dithiolo[4,5-b]quinoxalin-2-one |
| CAS Reg. No.: | 2439-01-2 |
| Formula: | C10H6N2OS2 |
| Activity: | acaricides (quinoxaline) fungicides (quinoxaline) |
| Notes: | The name “oxythioquinox” is used in Australia, the name “quinomethionate” was formerly approved by the British Standards Institution, and the name “chinomethionate” (灭螨猛) is approved in China. |
| Structure: |  |
| Pronunciation: | chǐn-ō-mě-thī-ǒn-ǎt Guide to British pronunciation |
| InChIKey: | FBQQHUGEACOBDN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |