Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 1-chloro-2,4-dinitronaphthalene |
IUPAC name: | 1-chloro-2,4-dinitronaphthalene |
CAS name: | 1-chloro-2,4-dinitronaphthalene |
CAS Reg. No.: | 2401-85-6 |
Formula: | C10H5ClN2O4 |
Activity: | fungicides (nitrobenzene) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name, though there seems to be only one active isomer. |
Structure: | |
Pronunciation: | klor-ō-dī-nī-trō-nǎf-tha-lēnz Guide to British pronunciation |
InChIKey: | SKKUAUZTZZRYPW-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H5ClN2O4/c11-10-7-4-2-1-3-6(7)8(12(14)15)5-9(10)13(16)17/h1-5H |
A data sheet from the Compendium of Pesticide Common Names