| Approval: |
ISO common name not required |
| IUPAC PIN: |
1-chloro-2,4-dinitronaphthalene |
| IUPAC name: |
1-chloro-2,4-dinitronaphthalene |
| CAS name: |
1-chloro-2,4-dinitronaphthalene |
| CAS Reg. No.: |
2401-85-6 |
| Formula: |
C10H5ClN2O4 |
| Activity: |
fungicides (nitrobenzene) |
| Notes: |
This substance is considered by the International Organization for Standardization not to require a common name, though there seems to be only one active isomer. |
| Structure: |
 |
| Pronunciation: |
klor-ō-dī-nī-trō-nǎf-tha-lēnz Guide to British pronunciation |
| InChIKey: |
SKKUAUZTZZRYPW-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C10H5ClN2O4/c11-10-7-4-2-1-3-6(7)8(12(14)15)5-9(10)13(16)17/h1-5H |