| Approval: | ISO |
|---|---|
| IUPAC PIN: | (1Ξ,3S)-N′-[(E)-(4-chlorophenyl)methylidene]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide |
| IUPAC name: | (1RS,3S)-N′-[(E)-(4-chlorobenzylidene)]-2,3,4,9-tetrahydro-1-methyl-1H-pyrido[3,4-b]indole-3-carbohydrazide |
| CAS name: | (3S)-2,3,4,9-tetrahydro-1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid (2E)-2-[(4-chlorophenyl)methylene]hydrazide |
| CAS Reg. No.: | 2442449-10-5 |
| Formula: | C20H19ClN4O |
| Activity: | fungicides (hydrazide) virucides |
| Notes: | |
| Structure: | |
| Pronunciation: | klor-ō-ǐn-kǒn-a-zīd Guide to British pronunciation |
| InChIKey: | KMNVHTXBKWKMBA-KMRULJOSSA-N |
| InChI: | InChI=1S/C20H19ClN4O/c1-12-19-16(15-4-2-3-5-17(15)24-19)10-18(23-12)20(26)25-22-11-13-6-8-14(21)9-7-13/h2-9,11-12,18,23-24H,10H2,1H3,(H,25,26)/b22-11+/t12?,18-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names