| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
| IUPAC name: | tetrachloroisophthalonitrile |
| CAS name: | 2,4,5,6-tetrachloro-1,3-benzenedicarbonitrile |
| CAS Reg. No.: | 1897-45-6 |
| Formula: | C8Cl4N2 |
| Activity: | fungicides (chloronitrile) |
| Notes: | The name “TPN” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | |
| Pronunciation: | klor-ō-thǎl-ō-nǐl Guide to British pronunciation |
| InChIKey: | CRQQGFGUEAVUIL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
A data sheet from the Compendium of Pesticide Common Names