| Approval: | ISO |
|---|---|
| IUPAC PIN: | 4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione |
| IUPAC name: | 4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione 1979 Rules: 3-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}glutarimide |
| CAS name: | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione |
| CAS Reg. No.: | 66-81-9 |
| Formula: | C15H23NO4 |
| Activity: | fungicides (antibiotic) plant growth regulators (unclassified) |
| Notes: | The name “cicloheximide” is approved by the World Health Organization; the Chinese version is “环己米特” and the Russian version is “циклогексимид”. |
| Structure: |  |
| Pronunciation: | sī-clō-hěks-ǐ-mīd Guide to British pronunciation |
| InChIKey: | YPHMISFOHDHNIV-FSZOTQKASA-N |
| InChI: | InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 |