| Approval: | none |
|---|---|
| IUPAC PIN: | (2Ξ)-N-(2,4-dimethylphenyl)-3-methyl-1,3-thiazol-2(3H)-imine |
| IUPAC name: | (2EZ)-N-(2,4-dimethylphenyl)-3-methylthiazol-2(3H)-imine 1979 Rules: N-[(2EZ)-3-methylthiazol-2(3H)-ylidene]-2,4-xylidine |
| CAS name: | 2,4-dimethyl-N-(3-methyl-2(3H)-thiazolylidene)benzenamine |
| CAS Reg. No.: | 61676-87-7 |
| Formula: | C12H14N2S |
| Activity: | acaricides (formamidine) |
| Notes: | There is no ISO common name for this substance; the names “cymiazole” and “xymiazole” have been used in the literature but they have no official approval. The name “tifatol” (螨蜱胺) is approved in China, even though Tifatol is (or was) a registered trade mark in many countries. Derivatives include cymiazole hydrochloride [121034-85-3]. |
| Structure: | |
| Pronunciation: | sī-mē-a-zōl Guide to British pronunciation |
| InChIKey: | YUAUPYJCVKNAEC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14N2S/c1-9-4-5-11(10(2)8-9)13-12-14(3)6-7-15-12/h4-8H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names