| Approval: | none |
|---|---|
| IUPAC name: | N-[(2EZ)-3-methylthiazol-2(3H)-ylidene]-2,4-xylidine hydrochloride |
| CAS name: | 2,4-dimethyl-N-(3-methyl-2(3H)-thiazolylidene)benzenamine hydrochloride (1:1) |
| CAS Reg. No.: | 121034-85-3 |
| Formula: | C12H15ClN2S |
| Activity: | acaricides (formamidine) |
| Notes: | There is no ISO common name for this substance; the name “cymiazole hydrochloride” has been used in the literature but it has no official approval. This substance is a derivative of cymiazole [61676-87-7]. |
| Structure: |  |
| Pronunciation: | sī-mē-a-zōl hī-drō-klor-ǐd Guide to British pronunciation |
| InChIKey: | WDSSGOOJORKJEC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14N2S.ClH/c1-9-4-5-11(10(2)8-9)13-12-14(3)6-7-15-12;/h4-8H,1-3H3;1H |