| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-2-butoxypropyl (2,4-dichlorophenoxy)acetate |
| IUPAC name: | (RS)-2-butoxypropyl (2,4-dichlorophenoxy)acetate |
| CAS name: | 2-butoxypropyl 2-(2,4-dichlorophenoxy)acetate |
| CAS Reg. No.: | 1320-18-9 |
| Formula: | C15H20Cl2O4 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. This substance was previously known as 2,4-D-2-butoxypropyl. |
| Structure: | |
| Pronunciation: | too for dē dō-bǒks-īl Guide to British pronunciation |
| InChIKey: | LRWRQXJLRYTGCK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H20Cl2O4/c1-3-4-7-19-11(2)9-21-15(18)10-20-14-6-5-12(16)8-13(14)17/h5-6,8,11H,3-4,7,9-10H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names