Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid |
IUPAC name: | (2,4-dichlorophenoxy)acetic acid |
CAS name: | 2-(2,4-dichlorophenoxy)acetic acid |
CAS Reg. No.: | 94-75-7 |
Formula: | C8H6Cl2O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example 2,4-D-ammonium [2307-55-3], 2,4-D-butotyl [1929-73-3], 2,4-D-butyl [94-80-4], 2,4-D-choline [1048373-72-3], 2,4-D-diethylammonium [20940-37-8], 2,4-D-dimethylammonium [2008-39-1], 2,4-D-diolamine [5742-19-8], 2,4-D-doboxyl [1320-18-9], 2,4-D-dodecylammonium [2212-54-6], 2,4-D-etexyl [1928-43-4], 2,4-D-ethyl [533-23-3], 2,4-D-heptylammonium [37102-63-9], 2,4-D-isobutyl [1713-15-1], 2,4-D-isoctyl [25168-26-7], 2,4-D-isopropyl [94-11-1], 2,4-D-isopropylammonium [5742-17-6], 2,4-D-lithium [3766-27-6], 2,4-D-meptyl [1917-97-1], 2,4-D-methyl [1928-38-7], 2,4-D-methylammonium [51173-63-8], 2,4-D-octyl [1928-44-5], 2,4-D-pentyl [1917-92-6], 2,4-D-potassium [14214-89-2], 2,4-D-propyl [1928-61-6], 2,4-D-sodium [2702-72-9], 2,4-D-tefuryl [15146-99-3], 2,4-D-terboxyl [1928-45-6], 2,4-D-tetradecylammonium [28685-18-9], 2,4-D-triethylammonium [2646-78-8], 2,4-D-tripromine [18584-79-7], 2,4-D-trolamine [2569-01-9]. One complex ester of 2,4-D has its own common name, clacyfos [215655-76-8]. |
Structure: | |
Pronunciation: | too for dē Guide to British pronunciation |
InChIKey: | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names