| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | pentyl (2,4-dichlorophenoxy)acetate |
| IUPAC name: | pentyl (2,4-dichlorophenoxy)acetate |
| CAS name: | pentyl 2-(2,4-dichlorophenoxy)acetate |
| CAS Reg. No.: | 1917-92-6 |
| Formula: | C13H16Cl2O3 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | |
| Pronunciation: | too for dē pěn-tīl Guide to British pronunciation |
| InChIKey: | VZCCHPAEDSPPDG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H16Cl2O3/c1-2-3-4-7-17-13(16)9-18-12-6-5-10(14)8-11(12)15/h5-6,8H,2-4,7,9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names