| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-octan-2-yl (2,4-dichlorophenoxy)acetate |
| IUPAC name: | (RS)-1-methylheptyl (2,4-dichlorophenoxy)acetate |
| CAS name: | 1-methylheptyl 2-(2,4-dichlorophenoxy)acetate |
| CAS Reg. No.: | 1917-97-1 |
| Formula: | C16H22Cl2O3 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | |
| Pronunciation: | too for dē měp-tīl Guide to British pronunciation |
| InChIKey: | GJNVTNDAZUATRV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H22Cl2O3/c1-3-4-5-6-7-12(2)21-16(19)11-20-15-9-8-13(17)10-14(15)18/h8-10,12H,3-7,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names