| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 3-butoxypropyl (2,4-dichlorophenoxy)acetate |
| IUPAC name: | 3-butoxypropyl (2,4-dichlorophenoxy)acetate |
| CAS name: | 3-butoxypropyl 2-(2,4-dichlorophenoxy)acetate |
| CAS Reg. No.: | 1928-45-6 |
| Formula: | C15H20Cl2O4 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. This substance was previously known as 2,4-D-3-butoxypropyl. |
| Structure: | |
| Pronunciation: | too for dē ter-bǒks-īl Guide to British pronunciation |
| InChIKey: | KZWPFFFDRDASOU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H20Cl2O4/c1-2-3-7-19-8-4-9-20-15(18)11-21-14-6-5-12(16)10-13(14)17/h5-6,10H,2-4,7-9,11H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names