| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | propyl (2,4-dichlorophenoxy)acetate |
| IUPAC name: | propyl (2,4-dichlorophenoxy)acetate |
| CAS name: | propyl 2-(2,4-dichlorophenoxy)acetate |
| CAS Reg. No.: | 1928-61-6 |
| Formula: | C11H12Cl2O3 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | |
| Pronunciation: | too for dē prō-pīl Guide to British pronunciation |
| InChIKey: | URELEWKDONECLX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H12Cl2O3/c1-2-5-15-11(14)7-16-10-4-3-8(12)6-9(10)13/h3-4,6H,2,5,7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names