| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 2-methylpropyl (2Ξ)-3-[benzyl(methyl)amino]-2-cyanoprop-2-enoate |
| IUPAC name: | 2-methylpropyl (EZ)-3-[benzyl(methyl)amino]-2-cyanoprop-2-enoate 1979 Rules: isobutyl (EZ)-3-[benzyl(methyl)amino]-2-cyanoacrylate |
| CAS name: | 2-methylpropyl 2-cyano-3-[methyl(phenylmethyl)amino]-2-propenoate |
| CAS Reg. No.: | 88107-27-1 |
| Formula: | C16H20N2O2 |
| Activity: | fungicides (aminocyanoacrylate) |
| Notes: | This substance is a derivative of benzamacril [127087-86-9]. |
| Structure: | |
| Pronunciation: | běnz-ǎm-a-krǐl ī-sō-bū-tīl Guide to British pronunciation |
| InChIKey: | NDAWJMAYLOFILH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H20N2O2/c1-13(2)12-20-16(19)15(9-17)11-18(3)10-14-7-5-4-6-8-14/h4-8,11,13H,10,12H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names