| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 2-(methoxyformamido)-1H-1,3-benzimidazol-3-ium benzenesulfonate |
| IUPAC name: | 2-(methoxycarbonylamino)-1H-3,1-benzimidazol-3-ium benzenesulfonate |
| CAS name: | 2-[(methoxycarbonyl)amino]-1H-3,1-benzimidazolium benzenesulfonate (1:1) |
| CAS Reg. No.: | |
| Formula: | C15H15N3O5S |
| Activity: | fungicides (benzimidazole) |
| Notes: | This substance is a derivative of carbendazim [10605-21-7]. The names “carbendazim besilate” and “carbendazim besylate” have been used in the literature, following the conventions of WHO and USAN, respectively. |
| Structure: |  |
| Pronunciation: | kar-běn-da-zǐm běn-zēn-sǔl-fǒn-āt Guide to British pronunciation |
| InChIKey: | BETXRQJSPWNKEZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9N3O2.C6H6O3S/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8;7-10(8,9)6-4-2-1-3-5-6/h2-5H,1H3,(H2,10,11,12,13);1-5H,(H,7,8,9) |