| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 3-amino-2,5-dichlorobenzoic acid—2,2′-azanediyldi(ethan-1-ol) (1/1) |
| IUPAC name: | 3-amino-2,5-dichlorobenzoic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium 3-amino-2,5-dichlorobenzoate |
| CAS name: | 3-amino-2,5-dichlorobenzoic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| CAS Reg. No.: | 53404-16-3 |
| Formula: | C11H16Cl2N2O4 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of chloramben [133-90-4]. |
| Structure: | |
| Pronunciation: | klor-ǎm-běn dī-ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | NXZLJFLADUDSQR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H5Cl2NO2.C4H11NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3;6-3-1-5-2-4-7/h1-2H,10H2,(H,11,12);5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names