Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 3-amino-2,5-dichlorobenzoic acid—2,2′-azanediyldi(ethan-1-ol) (1/1) |
IUPAC name: | 3-amino-2,5-dichlorobenzoic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium 3-amino-2,5-dichlorobenzoate |
CAS name: | 3-amino-2,5-dichlorobenzoic acid compound with 2,2′-iminobis[ethanol] (1:1) |
CAS Reg. No.: | 53404-16-3 |
Formula: | C11H16Cl2N2O4 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a derivative of chloramben [133-90-4]. |
Structure: | |
Pronunciation: | klor-ǎm-běn dī-ǒl-a-mēn Guide to British pronunciation |
InChIKey: | NXZLJFLADUDSQR-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H5Cl2NO2.C4H11NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3;6-3-1-5-2-4-7/h1-2H,10H2,(H,11,12);5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names