| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3-amino-2,5-dichlorobenzoic acid |
| IUPAC name: | 3-amino-2,5-dichlorobenzoic acid |
| CAS name: | 3-amino-2,5-dichlorobenzoic acid |
| CAS Reg. No.: | 133-90-4 |
| Formula: | C7H5Cl2NO2 |
| Activity: | herbicides (benzoic acid) |
| Notes: | The Chinese name “草灭喂” has been used in the literature, but it has no official approval. Derivatives include chloramben-ammonium [1076-46-6], chloramben-diolamine [53404-16-3], chloramben-methyl [7286-84-2], chloramben-methylammonium [25182-03-0], chloramben-sodium [1954-81-0]. |
| Structure: |  |
| Pronunciation: | klor-ǎm-běn Guide to British pronunciation |
| InChIKey: | HSSBORCLYSCBJR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H,11,12) |