Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | sodium 3-amino-2,5-dichlorobenzoate |
IUPAC name: | sodium 3-amino-2,5-dichlorobenzoate |
CAS name: | 3-amino-2,5-dichlorobenzoic acid monosodium salt |
CAS Reg. No.: | 1954-81-0 |
Formula: | C7H4Cl2NNaO2 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a derivative of chloramben [133-90-4]. |
Structure: | |
Pronunciation: | klor-ǎm-běn sō-dē-am Guide to British pronunciation |
InChIKey: | WMWBBXKLYSGKDY-UHFFFAOYSA-M |
InChI: | InChI=1S/C7H5Cl2NO2.Na/c8-3-1-4(7(11)12)6(9)5(10)2-3;/h1-2H,10H2,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names