| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 3-amino-2,5-dichlorobenzoic acid—methanamine (1/1) |
| IUPAC name: | 3-amino-2,5-dichlorobenzoic acid - methylamine (1:1) or methylammonium 3-amino-2,5-dichlorobenzoate |
| CAS name: | 3-amino-2,5-dichlorobenzoic acid compound with methanamine (1:1) |
| CAS Reg. No.: | 25182-03-0 |
| Formula: | C8H10Cl2N2O2 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of chloramben [133-90-4]. |
| Structure: | |
| Pronunciation: | klor-ǎm-běn mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | SGSBXGMWMFNPKQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H5Cl2NO2.CH5N/c8-3-1-4(7(11)12)6(9)5(10)2-3;1-2/h1-2H,10H2,(H,11,12);2H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names