| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | diammonium (1Ξ,2Ξ,3Ξ,4Ξ)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| IUPAC name: | diammonium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| CAS name: | diammonium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| CAS Reg. No.: | 17439-94-0 |
| Formula: | C8H16N2O5 |
| Activity: | algicides herbicides (unclassified) plant growth regulators (defoliant) |
| Notes: | This substance is a derivative of endothal [145-73-3]. |
| Structure: | |
| Pronunciation: | ěn-dō-thǎl dī-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | NJPDFPLPWOPSKC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H10O5.2H3N/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-6H,1-2H2,(H,9,10)(H,11,12);2*1H3 |
A data sheet from the Compendium of Pesticide Common Names