| Approval: | ISO |
|---|---|
| IUPAC PIN: | (1Ξ,2Ξ,3Ξ,4Ξ)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| IUPAC name: | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| CAS name: | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| CAS Reg. No.: | 145-73-3 |
| Formula: | C8H10O5 |
| Activity: | algicides herbicides (unclassified) plant growth regulators (defoliant) |
| Notes: | Derivatives include endothal-diammonium [17439-94-0], endothal-dipotassium [2164-07-0], endothal-disodium [129-67-9]. The name “endothall” is approved by the Weed Science Society of America. The name “endothal-sodium” was formerly approved by ISO for the disodium salt, but it was replaced by the name “endothal” for the acid. |
| Structure: | |
| Pronunciation: | ěn-dō-thǎl Guide to British pronunciation |
| InChIKey: | GXEKYRXVRROBEV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H10O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names