| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate |
| IUPAC name: | benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate or benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropicolinate |
| CAS name: | phenylmethyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylate |
| CAS Reg. No.: | 1390661-72-9 |
| Formula: | C20H14Cl2F2N2O3 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of florpyrauxifen [943832-81-3]. |
| Structure: | |
| Pronunciation: | flor-pīr-orks-ǐ-fěn běn-zīl Guide to British pronunciation |
| InChIKey: | WNZCDFOXYNRBRB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C20H14Cl2F2N2O3/c1-28-19-12(21)8-7-11(14(19)23)17-15(24)16(25)13(22)18(26-17)20(27)29-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H2,25,26) |
A data sheet from the Compendium of Pesticide Common Names