Approval: | ISO |
---|---|
IUPAC PIN: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
IUPAC name: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid pre-1969 name: 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropicolinic acid |
CAS name: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylic acid |
CAS Reg. No.: | 943832-81-3 |
Formula: | C13H8Cl2F2N2O3 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example florpyrauxifen-benzyl [1390661-72-9]. |
Structure: | |
Pronunciation: | flor-pīr-orks-ǐ-fěn Guide to British pronunciation |
InChIKey: | XFZUQTKDBCOXPP-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H8Cl2F2N2O3/c1-22-12-5(14)3-2-4(7(12)16)10-8(17)9(18)6(15)11(19-10)13(20)21/h2-3H,1H3,(H2,18,19)(H,20,21) |
A data sheet from the Compendium of Pesticide Common Names