| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| IUPAC name: | cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate or cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)picolinate |
| CAS name: | cyanomethyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-2-pyridinecarboxylate |
| CAS Reg. No.: | 2251111-18-7 |
| Formula: | C16H9ClF2N4O2 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of indolauxipyr [1628702-28-2]. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | OVIZXYUPMXRUSD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H9ClF2N4O2/c17-9-12(21)11(19)14(23-15(9)16(24)25-6-4-20)8-2-1-7-3-5-22-13(7)10(8)18/h1-3,5,22H,6H2,(H2,21,23) |
A data sheet from the Compendium of Pesticide Common Names