Approval: | ISO |
---|---|
IUPAC PIN: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid |
IUPAC name: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid pre-1969 name: 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)picolinic acid |
CAS name: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-2-pyridinecarboxylic acid |
CAS Reg. No.: | 1628702-28-2 |
Formula: | C14H8ClF2N3O2 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example indolauxipyr-cyanomethyl [2251111-18-7] |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | CIPJEXPBJDLNIP-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H8ClF2N3O2/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16/h1-4,19H,(H2,18,20)(H,21,22) |
A data sheet from the Compendium of Pesticide Common Names