| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | potassium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
| IUPAC name: | potassium (R)-2-[(4-chloro-o-tolyl)oxy]propionate |
| CAS name: | potassium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
| CAS Reg. No.: | 66423-05-0 |
| Formula: | C10H10ClKO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | This substance is a derivative of mecoprop-P [16484-77-8]. The unresolved racemic mixture of this substance has the ISO common name mecoprop-potassium [1929-86-8]. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp pē pa-tǎs-ē-am Guide to British pronunciation |
| InChIKey: | OFCQYQOZASISIU-OGFXRTJISA-M |
| InChI: | InChI=1S/C10H11ClO3.K/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h3-5,7H,1-2H3,(H,12,13);/q;+1/p-1/t7-;/m1./s1 |