| Approval: | ISO |
|---|---|
| IUPAC PIN: | (2R)-2-(4-chloro-2-methylphenoxy)propanoic acid |
| IUPAC name: | (2R)-2-(4-chloro-2-methylphenoxy)propanoic acid 1979 Rules: (R)-2-[(4-chloro-o-tolyl)oxy]propionic acid |
| CAS name: | (2R)-2-(4-chloro-2-methylphenoxy)propanoic acid |
| CAS Reg. No.: | 16484-77-8 |
| Formula: | C10H11ClO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | Derivatives include mecoprop-P-dimethylammonium [66423-09-4], mecoprop-P-etexyl [861229-15-4], mecoprop-P-isobutyl [101012-85-5], mecoprop-P-potassium [66423-05-0]. The unresolved racemic mixture of this substance has the ISO common name mecoprop [93-65-2]. |
| Structure: | |
| Pronunciation: | měk-o-prǒp pē Guide to British pronunciation |
| InChIKey: | WNTGYJSOUMFZEP-SSDOTTSWSA-N |
| InChI: | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names