| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | |
| IUPAC name: | methylmercury(II) pentachlorophenolate or methylmercury(II) pentachlorophenoxide or methylmercury(2+) pentachlorophenolate or methylmercury(2+) pentachlorophenoxide or methylmercuric pentachlorophenolate or methylmercuric pentachlorophenoxide |
| CAS name: | methyl(pentachlorophenolato-κO)mercury |
| CAS Reg. No.: | |
| Formula: | C7H3Cl5HgO |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is a derivative of pentachlorophenol [87-86-5]. |
| Structure: | |
| Pronunciation: | mē-thīl-mer-kūr-ē pěn-ta-klor-ō-fěn-ǒk-sīd Guide to British pronunciation |
| InChIKey: | QFSGULCPPNDNPU-UHFFFAOYSA-M |
| InChI: | InChI=1S/C6HCl5O.CH3.Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;1H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names