Approval: | none |
---|---|
IUPAC PIN: | pentachlorophenyl dodecanoate |
IUPAC name: | pentachlorophenyl dodecanoate |
CAS name: | 2,3,4,5,6-pentachlorophenyl dodecanoate |
CAS Reg. No.: | 3772-94-9 |
Formula: | C18H23Cl5O2 |
Activity: | algicides fungicides (phenol) |
Notes: | This substance is a derivative of pentachlorophenol [87-86-5]. Other fatty acid moieties ranging from C6 to C20 may also be present. |
Structure: | |
Pronunciation: | pěn-ta-klor-ō-fē-nīl lor-āt Guide to British pronunciation |
InChIKey: | MKNJWAXSYGAMGJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H23Cl5O2/c1-2-3-4-5-6-7-8-9-10-11-12(24)25-18-16(22)14(20)13(19)15(21)17(18)23/h2-11H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names