| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | |
| IUPAC name: | 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-13-ium chloride |
| CAS name: | 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride (1:1) |
| CAS Reg. No.: | 5578-73-4 |
| Formula: | C20H14ClNO4 |
| Activity: | acaricides (alkaloid) fungicides (alkaloid) insecticides (alkaloid) |
| Notes: | This substance is a derivative of sanguinarine [2447-54-3]. The name “sanguinarium chloride” is approved by the World Health Organization; the Chinese version is “血根氯铵”, the French version is “chlorure de sanguinarium”, and the Russian version is “сангвинария хлорид”. |
| Structure: | |
| Pronunciation: | sǎng-gwǐn-a-rēn klor-ǐd Guide to British pronunciation |
| InChIKey: | GIZKAXHWLRYMLE-UHFFFAOYSA-M |
| InChI: | InChI=1S/C20H14NO4.ClH/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21;/h2-8H,9-10H2,1H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names