| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | sodium pentachlorophenoxide |
| IUPAC name: | sodium pentachlorophenoxideorsodium pentachlorophenolate |
| CAS name: | 2,3,4,5,6-pentachlorophenol sodium salt |
| CAS Reg. No.: | 131-52-2 |
| Formula: | C6Cl5O |
| Activity: | molluscicides fungicides (phenol) |
| Notes: | This substance is a derivative of pentachlorophenol [87-86-5]. This substance is considered by the International Organization for Standardization not to require a common name. The name “sodium pentachlorophenoxide” is an alternative.The name “PCP-Na” (五氯酚钠) is approved in China. |
| Structure: | |
| Pronunciation: | em>sō-dē-am pěn-ta-klor-ō-fěn-ā Guide to British pronunciation |
| InChIKey: | HCJLVWUMMKIQIM-UHFFFAOYSA-MN |
| InChI: | InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names