| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,6-dichloro-4-nitroaniline |
| IUPAC name: | 2,6-dichloro-4-nitroaniline |
| CAS name: | 2,6-dichloro-4-nitrobenzenamine |
| CAS Reg. No.: | 99-30-9 |
| Formula: | C6H4Cl2N2O2 |
| Activity: | fungicides (aromatic) |
| Notes: | The name “dicloran” was formerly approved by the British Standards Institution. |
| Structure: | |
| Pronunciation: | dī-klor-ǎn Guide to British pronunciation |
| InChIKey: | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
A data sheet from the Compendium of Pesticide Common Names