| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | diethyl dicarbonate |
| IUPAC name: | diethyl dicarbonate |
| CAS name: | diethyl dicarbonate |
| CAS Reg. No.: | 1609-47-8 |
| Formula: | C6H10O5 |
| Activity: | fungicides (unclassified) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | dī-ē-thǐl pīr-ō-kǎr-ban-āt Guide to British pronunciation |
| InChIKey: | FFYPMLJYZAEMQB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10O5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names