| Approval: | China |
|---|---|
| IUPAC PIN: | 1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
| IUPAC name: | 1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione 1979 Rules: N-(3,5-dichlorophenyl)succinimide |
| CAS name: | 1-(3,5-dichlorophenyl)-2,5-pyrrolidinedione |
| CAS Reg. No.: | 24096-53-5 |
| Formula: | C10H7Cl2NO2 |
| Activity: | fungicides (dicarboximide) |
| Notes: | There is no ISO common name for this substance; the name “dimetachlone” (菌核净) is approved in China. The name “dimethachlone” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | dī-mět-a-klōn Guide to British pronunciation |
| InChIKey: | CFZLNRGUBAVQNO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H7Cl2NO2/c11-6-3-7(12)5-8(4-6)13-9(14)1-2-10(13)15/h3-5H,1-2H2 |