| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 5-butyl-2-(dimethylamino)-6-methylpyrimidin-4-ol | 
| IUPAC name: | 5-butyl-2-(dimethylamino)-6-methylpyrimidin-4-ol | 
| CAS name: | 5-butyl-2-(dimethylamino)-6-methyl-4(1H)-pyrimidinone | 
| CAS Reg. No.: | 5221-53-4 | 
| Formula: | C11H19N3O | 
| Activity: | fungicides (aminopyrimidinol) | 
| Notes: | |
| Structure: | |
| Pronunciation: | dī-mě-thǐr-ǐ-mǒl Guide to British pronunciation | 
| InChIKey: | CJHXCRMKMMBYJQ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C11H19N3O/c1-5-6-7-9-8(2)12-11(14(3)4)13-10(9)15/h5-7H2,1-4H3,(H,12,13,15) | 
A data sheet from the Compendium of Pesticide Common Names