| Approval: | ISO |
|---|---|
| IUPAC PIN: | (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide |
| IUPAC name: | (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide 1979 Rules: (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide |
| CAS name: | (αE)-2-[(2,5-dimethylphenoxy)methyl]-α-(methoxyimino)-N-methylbenzeneacetamide |
| CAS Reg. No.: | 149961-52-4 |
| Formula: | C19H22N2O3 |
| Activity: | fungicides (oximinoacetamide) |
| Notes: | |
| Structure: | |
| Pronunciation: | dī-mǒks-ē-strō-bǐn Guide to British pronunciation |
| InChIKey: | WXUZAHCNPWONDH-DYTRJAOYSA-N |
| InChI: | InChI=1S/C19H22N2O3/c1-13-9-10-14(2)17(11-13)24-12-15-7-5-6-8-16(15)18(21-23-4)19(22)20-3/h5-11H,12H2,1-4H3,(H,20,22)/b21-18+ |
A data sheet from the Compendium of Pesticide Common Names