Approval: | ISO |
---|---|
IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenyl propan-2-yl carbonate |
IUPAC name: | isopropyl 2-[(1RS)-1-methylpropyl]-4,6-dinitrophenyl carbonate 1979 Rules: (RS)-2-sec-butyl-4,6-dinitrophenyl isopropyl carbonate |
CAS name: | 1-methylethyl 2-(1-methylpropyl)-4,6-dinitrophenyl carbonate |
CAS Reg. No.: | 973-21-7 |
Formula: | C14H18N2O7 |
Activity: | acaricides (dinitrophenol) fungicides (dinitrophenol) |
Notes: | |
Structure: | |
Pronunciation: | dī-nō-bū-tǒn Guide to British pronunciation |
InChIKey: | HDWLUGYOLUHEMN-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H18N2O7/c1-5-9(4)11-6-10(15(18)19)7-12(16(20)21)13(11)23-14(17)22-8(2)3/h6-9H,5H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names