Approval: | ISO |
---|---|
IUPAC PIN: | 2,2′-disulfanediyldi(pyridin-1-ium-1-olate) |
IUPAC name: | 2,2′-dithiodi(pyridin-1-ium-1-olate) |
CAS name: | 2,2′-dithiobis[pyridine] 1,1′-dioxide |
CAS Reg. No.: | 3696-28-4 |
Formula: | C10H8N2O2S2 |
Activity: | bactericides fungicides (pyridine) |
Notes: | The name “dipyrithione” is also approved by the World Health Organization. |
Structure: | |
Pronunciation: | dī-pīr-ǐ-thī-ōn Guide to British pronunciation |
InChIKey: | ZHDBTKPXEJDTTQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H8N2O2S2/c13-11-7-3-1-5-9(11)15-16-10-6-2-4-8-12(10)14/h1-8H |
A data sheet from the Compendium of Pesticide Common Names