| Approval: | ISO |
|---|---|
| IUPAC PIN: | 5,6-dihydro-3H-imidazo[2,1-c][1,2,4]dithiazole-3-thione |
| IUPAC name: | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione |
| CAS name: | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione |
| CAS Reg. No.: | 33813-20-6 |
| Formula: | C4H4N2S3 |
| Activity: | fungicides (dithiocarbamate) |
| Notes: | The name “ETM” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. Originally misidentified as hexahydro-1,3,6-thiadiazepine-2,7-dithione [5782-83-3]. |
| Structure: | |
| Pronunciation: | ē-těm Guide to British pronunciation |
| InChIKey: | BFTGQIQVUVTBJU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H4N2S3/c7-4-6-2-1-5-3(6)8-9-4/h1-2H2 |
A data sheet from the Compendium of Pesticide Common Names