| Approval: | ISO preferred name |
|---|---|
| IUPAC name: | (RS)-3-(ethylmercurythio)propane-1,2-diol |
| CAS name: | ethyl[3-(mercapto-κS)-1,2-propanediolato]mercury |
| CAS Reg. No.: | 2597-92-4 |
| Formula: | C5H12HgO2S |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | ē-thīl-mer-kūr-ē too thrē dī-hī-drǒks-ē-prō-pīl mer-kǎp-tīd Guide to British pronunciation |
| InChIKey: | KVJOLVBEUYUHLD-UHFFFAOYSA-M |
| InChI: | InChI=1S/C3H8O2S.C2H5.Hg/c4-1-3(5)2-6;1-2;/h3-6H,1-2H2;1H2,2H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names