| Approval: | China |
|---|---|
| IUPAC PIN: | 1-(2-hydroxyphenyl)butan-1-one |
| IUPAC name: | 1-(2-hydroxyphenyl)butan-1-one 1979 Rules: 2′-hydroxybutyrophenone |
| CAS name: | 1-(2-hydroxyphenyl)-1-butanone |
| CAS Reg. No.: | 2887-61-8 |
| Formula: | C10H12O2 |
| Activity: | fungicides (phenol) |
| Notes: | There is no ISO common name for this substance; the name “fenjuntong” (酚菌酮) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | GUDQIKIAWOAOFP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12O2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h3-4,6-7,12H,2,5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names