| Approval: | ISO |
|---|---|
| IUPAC PIN: | (2Ξ)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-(morpholin-4-yl)prop-2-en-1-one [50% (E)-isomer, 50% (Z)-isomer] |
| IUPAC name: | (2EZ)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-(morpholin-4-yl)propenone [50% (E)-isomer, 50% (Z)-isomer] 1979 Rules: (EZ)-4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)acryloyl]morpholine [50% (E)-isomer, 50% (Z)-isomer] |
| CAS name: | 4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-oxo-2-propen-1-yl]morpholine |
| CAS Reg. No.: | 211867-47-9 |
| Formula: | C21H22FNO4 |
| Activity: | fungicides (cinnamamide) |
| Notes: | |
| Structure: | |
| Pronunciation: | floo-morf Guide to British pronunciation |
| InChIKey: | BKBSMMUEEAWFRX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C21H22FNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names