Approval: | ISO |
---|---|
IUPAC PIN: | ethyl hydrogen phosphonate |
IUPAC name: | ethyl hydrogen phosphonate |
CAS name: | ethyl hydrogen phosphonate |
CAS Reg. No.: | 15845-66-6 |
Formula: | C2H7O3P |
Activity: | fungicides (phosphonate) plant activators |
Notes: | Derivatives include fosetyl-aluminium [39148-24-8] (this would be called fosetyl-aluminum in the USA). The name “phosethyl” has been used in the literature, but it has no official approval. |
Structure: | |
Pronunciation: | fǒs-ē-tīl Guide to British pronunciation |
InChIKey: | VUERQRKTYBIULR-UHFFFAOYSA-N |
InChI: | InChI=1S/C2H7O3P/c1-2-5-6(3)4/h6H,2H2,1H3,(H,3,4) |
A data sheet from the Compendium of Pesticide Common Names