| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,5-dimethyl-N-phenylfuran-3-carboxamide |
| IUPAC name: | 2,5-dimethyl-3-furananilide 1979 Rules: 2,5-dimethyl-3-furanilide |
| CAS name: | 2,5-dimethyl-N-phenyl-3-furancarboxamide |
| CAS Reg. No.: | 28562-70-1 |
| Formula: | C13H13NO2 |
| Activity: | fungicides (furancarboxamide) |
| Notes: | |
| Structure: | |
| Pronunciation: | fūr-karb-a-nǐl Guide to British pronunciation |
| InChIKey: | XEPBBUCQCXXTGR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H13NO2/c1-9-8-12(10(2)16-9)13(15)14-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names