| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | 1L-1,3,4/2,5,6-1-deoxy-2,3,4,5,6-pentahydroxycyclohexyl 2-amino-2,3,4,6-tetradeoxy-4-(α-iminoglycino)-α-D-arabino-hexopyranoside or [5-amino-2-methyl-6-(2,3,4,5,6-pentahydroxycyclohexyloxy)tetrahydropyran-3-yl]amino-α-iminoacetic acid |
| CAS name: | 3-O-[2-amino-4-[(carboxyiminomethyl)amino]-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranosyl]-D-chiro-inositol |
| CAS Reg. No.: | 6980-18-3 |
| Formula: | C14H25N3O9 |
| Activity: | bactericides fungicides (hexopyranoside) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. This substance is named after the actinomycete from which it was isolated, Streptomyces kasugaensis. Derivatives include kasugamycin hydrochloride [19408-46-9]. |
| Structure: | |
| Pronunciation: | ka-soo-ga-mī-sǐn Guide to British pronunciation |
| InChIKey: | PVTHJAPFENJVNC-MHRBZPPQSA-N |
| InChI: | InChI=1S/C14H25N3O9/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24)/t3-,4+,5+,6-,7+,8+,9-,10+,11+,14-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names