| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | benzoato(methanido)mercury or methylmercury(II) benzoate or methylmercury(2+) benzoate or methylmercuric benzoate |
| CAS name: | (benzoato-κO)methylmercury |
| CAS Reg. No.: | 3626-13-9 |
| Formula: | C8H8HgO2 |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | mē-thīl-mer-kūr-ē běn-zō-āt Guide to British pronunciation |
| InChIKey: | WKDZZKIPDBZSRW-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H6O2.CH3.Hg/c8-7(9)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);1H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names